C33H38N4O11S — CID 102492987
prop-2-enyl (2S)-3-[[(2R)-3-methoxy-2-[(4-methylphenyl)sulfonylamino]-3-oxopropyl]-[(4-methoxyphenyl)methyl]amino]-2-[(4-nitrophenyl)methoxycarbonylamino]propanoate (PubChem CID 102492987) has the molecular formula C33H38N4O11S and a molecular weight of 698.75 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-[[(2R)-3-methoxy-2-[(4-methylphenyl)sulfonylamino]-3-oxopropyl]-[(4-methoxyphenyl)methyl]amino]-2-[(4-nitrophenyl)methoxycarbonylamino]propanoate.
| Compound Name | prop-2-enyl (2S)-3-[[(2R)-3-methoxy-2-[(4-methylphenyl)sulfonylamino]-3-oxopropyl]-[(4-methoxyphenyl)methyl]amino]-2-[(4-nitrophenyl)methoxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 102492987 |
| Molecular Formula | C33H38N4O11S |
| Molecular Weight | 698.75 g/mol |
| Exact Mass | 698.23 |
| IUPAC Name | prop-2-enyl (2S)-3-[[(2R)-3-methoxy-2-[(4-methylphenyl)sulfonylamino]-3-oxopropyl]-[(4-methoxyphenyl)methyl]amino]-2-[(4-nitrophenyl)methoxycarbonylamino]propanoate |
| SMILES | C=CCOC(=O)[C@H](CN(Cc1ccc(OC)cc1)C[C@@H](NS(=O)(=O)c1ccc(C)cc1)C(=O)OC)NC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H38N4O11S/c1-5-18-47-32(39)29(34-33(40)48-22-25-8-12-26(13-9-25)37(41)42)20-36(19-24-10-14-27(45-3)15-11-24)21-30(31(38)46-4)35-49(43,44)28-16-6-23(2)7-17-28/h5-17,29-30,35H,1,18-22H2,2-4H3,(H,34,40)/t29-,30+/m0/s1 |
| InChIKey | DKWYKEDJMBOHJQ-XZWHSSHBSA-N |
| XLogP | 3.26 |
| TPSA | 192.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|