C25H27NO4S — CID 132583319
N-[(2S)-1-(4-methoxyphenyl)-3-methyl-1-oxo-3-phenylbutan-2-yl]-4-methylbenzenesulfonamide (PubChem CID 132583319) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is N-[(2S)-1-(4-methoxyphenyl)-3-methyl-1-oxo-3-phenylbutan-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2S)-1-(4-methoxyphenyl)-3-methyl-1-oxo-3-phenylbutan-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 132583319 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[(2S)-1-(4-methoxyphenyl)-3-methyl-1-oxo-3-phenylbutan-2-yl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(C(=O)[C@@H](NS(=O)(=O)c2ccc(C)cc2)C(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO4S/c1-18-10-16-22(17-11-18)31(28,29)26-24(25(2,3)20-8-6-5-7-9-20)23(27)19-12-14-21(30-4)15-13-19/h5-17,24,26H,1-4H3/t24-/m1/s1 |
| InChIKey | MGKZICRLYVGZRR-XMMPIXPASA-N |
| XLogP | 4.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |