C35H32NO2PS2 — CID 71490225
N-[(Z,3R)-3-diphenylphosphinothioyl-1-(4-methylphenyl)-3-phenylprop-1-enyl]-4-methylbenzenesulfonamide (PubChem CID 71490225) has the molecular formula C35H32NO2PS2 and a molecular weight of 593.75 g/mol. Its IUPAC name is N-[(Z,3R)-3-diphenylphosphinothioyl-1-(4-methylphenyl)-3-phenylprop-1-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z,3R)-3-diphenylphosphinothioyl-1-(4-methylphenyl)-3-phenylprop-1-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71490225 |
| Molecular Formula | C35H32NO2PS2 |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | N-[(Z,3R)-3-diphenylphosphinothioyl-1-(4-methylphenyl)-3-phenylprop-1-enyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(/C(=C/[C@H](c2ccccc2)P(=S)(c2ccccc2)c2ccccc2)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H32NO2PS2/c1-27-18-22-29(23-19-27)34(36-41(37,38)33-24-20-28(2)21-25-33)26-35(30-12-6-3-7-13-30)39(40,31-14-8-4-9-15-31)32-16-10-5-11-17-32/h3-26,35-36H,1-2H3/b34-26-/t35-/m1/s1 |
| InChIKey | DQMPIWYMFBTRLZ-HOPZYGGHSA-N |
| XLogP | 7.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|