C20H26N2O2S2 — CID 102421610
(2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]-N-[(1S)-1-phenylethyl]butanethioamide (PubChem CID 102421610) has the molecular formula C20H26N2O2S2 and a molecular weight of 390.57 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]-N-[(1S)-1-phenylethyl]butanethioamide.
| Compound Name | (2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]-N-[(1S)-1-phenylethyl]butanethioamide |
|---|---|
| PubChem CID | 102421610 |
| Molecular Formula | C20H26N2O2S2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (2S)-3-methyl-2-[(4-methylphenyl)sulfonylamino]-N-[(1S)-1-phenylethyl]butanethioamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](C(=S)N[C@@H](C)c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C20H26N2O2S2/c1-14(2)19(20(25)21-16(4)17-8-6-5-7-9-17)22-26(23,24)18-12-10-15(3)11-13-18/h5-14,16,19,22H,1-4H3,(H,21,25)/t16-,19-/m0/s1 |
| InChIKey | MSQRVQIAKIMCIO-LPHOPBHVSA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|