C26H22Cl2NO2PS2 — CID 102310004
N-[(S)-bis(4-chlorophenyl)phosphinothioyl-phenylmethyl]-4-methylbenzenesulfonamide (PubChem CID 102310004) has the molecular formula C26H22Cl2NO2PS2 and a molecular weight of 546.48 g/mol. Its IUPAC name is N-[(S)-bis(4-chlorophenyl)phosphinothioyl-phenylmethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(S)-bis(4-chlorophenyl)phosphinothioyl-phenylmethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102310004 |
| Molecular Formula | C26H22Cl2NO2PS2 |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | N-[(S)-bis(4-chlorophenyl)phosphinothioyl-phenylmethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](c2ccccc2)P(=S)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H22Cl2NO2PS2/c1-19-7-17-25(18-8-19)34(30,31)29-26(20-5-3-2-4-6-20)32(33,23-13-9-21(27)10-14-23)24-15-11-22(28)12-16-24/h2-18,26,29H,1H3/t26-/m0/s1 |
| InChIKey | ZJEUCVWZXUGNEC-SANMLTNESA-N |
| XLogP | 6.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|