C17H19NO4S2 — CID 67587191
ethylsulfanyl 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate (PubChem CID 67587191) has the molecular formula C17H19NO4S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is ethylsulfanyl 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate.
| Compound Name | ethylsulfanyl 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 67587191 |
| Molecular Formula | C17H19NO4S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | ethylsulfanyl 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetate |
| SMILES | CCSOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO4S2/c1-3-23-22-17(19)16(14-7-5-4-6-8-14)18-24(20,21)15-11-9-13(2)10-12-15/h4-12,16,18H,3H2,1-2H3 |
| InChIKey | GZAUVEWGMZDCOT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|