C20H25NO4S — CID 5009964
ethyl 2-[(4-tert-butylphenyl)sulfonylamino]-2-phenylacetate (PubChem CID 5009964) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is ethyl 2-[(4-tert-butylphenyl)sulfonylamino]-2-phenylacetate.
| Compound Name | ethyl 2-[(4-tert-butylphenyl)sulfonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 5009964 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl 2-[(4-tert-butylphenyl)sulfonylamino]-2-phenylacetate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO4S/c1-5-25-19(22)18(15-9-7-6-8-10-15)21-26(23,24)17-13-11-16(12-14-17)20(2,3)4/h6-14,18,21H,5H2,1-4H3 |
| InChIKey | KVHBNYRJTQPWBJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |