C21H25NO5S — CID 141300159
ethyl 2-[3-[(4-tert-butylphenyl)sulfonylamino]phenyl]-3-oxopropanoate (PubChem CID 141300159) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is ethyl 2-[3-[(4-tert-butylphenyl)sulfonylamino]phenyl]-3-oxopropanoate.
| Compound Name | ethyl 2-[3-[(4-tert-butylphenyl)sulfonylamino]phenyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 141300159 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | ethyl 2-[3-[(4-tert-butylphenyl)sulfonylamino]phenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(C=O)c1cccc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C21H25NO5S/c1-5-27-20(24)19(14-23)15-7-6-8-17(13-15)22-28(25,26)18-11-9-16(10-12-18)21(2,3)4/h6-14,19,22H,5H2,1-4H3 |
| InChIKey | RAMBYXHQGYHJKG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|