C28H24INO2S — CID 10840704
N-[(Z)-3-iodo-1,2,3-triphenylprop-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 10840704) has the molecular formula C28H24INO2S and a molecular weight of 565.48 g/mol. Its IUPAC name is N-[(Z)-3-iodo-1,2,3-triphenylprop-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-3-iodo-1,2,3-triphenylprop-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10840704 |
| Molecular Formula | C28H24INO2S |
| Molecular Weight | 565.48 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | N-[(Z)-3-iodo-1,2,3-triphenylprop-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(/C(=C(\I)c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24INO2S/c1-21-17-19-25(20-18-21)33(31,32)30-28(24-15-9-4-10-16-24)26(22-11-5-2-6-12-22)27(29)23-13-7-3-8-14-23/h2-20,28,30H,1H3/b27-26- |
| InChIKey | RDGQAJIVPHWUDP-RQZHXJHFSA-N |
| XLogP | 7.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.48 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|