C16H14F3NO2S — CID 102415816
4-methyl-N-(2,3,3-trifluoro-1-phenylprop-2-enyl)benzenesulfonamide (PubChem CID 102415816) has the molecular formula C16H14F3NO2S and a molecular weight of 341.35 g/mol. Its IUPAC name is 4-methyl-N-(2,3,3-trifluoro-1-phenylprop-2-enyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(2,3,3-trifluoro-1-phenylprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102415816 |
| Molecular Formula | C16H14F3NO2S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 4-methyl-N-(2,3,3-trifluoro-1-phenylprop-2-enyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C(F)=C(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H14F3NO2S/c1-11-7-9-13(10-8-11)23(21,22)20-15(14(17)16(18)19)12-5-3-2-4-6-12/h2-10,15,20H,1H3 |
| InChIKey | IFSRTTFWVHHKGN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |