C19H20FNO3S — CID 134926200
N-[(1R)-1-(4-fluorophenyl)-2-methylidene-3-oxopentyl]-4-methylbenzenesulfonamide (PubChem CID 134926200) has the molecular formula C19H20FNO3S and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)-2-methylidene-3-oxopentyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)-2-methylidene-3-oxopentyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134926200 |
| Molecular Formula | C19H20FNO3S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)-2-methylidene-3-oxopentyl]-4-methylbenzenesulfonamide |
| SMILES | C=C(C(=O)CC)[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO3S/c1-4-18(22)14(3)19(15-7-9-16(20)10-8-15)21-25(23,24)17-11-5-13(2)6-12-17/h5-12,19,21H,3-4H2,1-2H3/t19-/m0/s1 |
| InChIKey | OZUHZCKPGONHML-IBGZPJMESA-N |
| XLogP | 3.69 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|