C18H18FNO4S — CID 102031493
N-[(1S)-1-(4-fluoro-2-hydroxyphenyl)-2-methylidene-3-oxobutyl]-4-methylbenzenesulfonamide (PubChem CID 102031493) has the molecular formula C18H18FNO4S and a molecular weight of 363.41 g/mol. Its IUPAC name is N-[(1S)-1-(4-fluoro-2-hydroxyphenyl)-2-methylidene-3-oxobutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1S)-1-(4-fluoro-2-hydroxyphenyl)-2-methylidene-3-oxobutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102031493 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[(1S)-1-(4-fluoro-2-hydroxyphenyl)-2-methylidene-3-oxobutyl]-4-methylbenzenesulfonamide |
| SMILES | C=C(C(C)=O)[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc(F)cc1O |
| InChI | InChI=1S/C18H18FNO4S/c1-11-4-7-15(8-5-11)25(23,24)20-18(12(2)13(3)21)16-9-6-14(19)10-17(16)22/h4-10,18,20,22H,2H2,1,3H3/t18-/m1/s1 |
| InChIKey | LQCUDKWQZGVPSY-GOSISDBHSA-N |
| XLogP | 3.00 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|