C17H16ClNO3S — CID 102577146
N-[1-(2-chlorophenyl)-2-formylprop-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 102577146) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)-2-formylprop-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(2-chlorophenyl)-2-formylprop-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102577146 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-[1-(2-chlorophenyl)-2-formylprop-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | C=C(C=O)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C17H16ClNO3S/c1-12-7-9-14(10-8-12)23(21,22)19-17(13(2)11-20)15-5-3-4-6-16(15)18/h3-11,17,19H,2H2,1H3 |
| InChIKey | UBAKOGVOWXIWJJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|