C21H21ClN2O2S — CID 71663028
N-[(2R)-2-anilino-2-(2-chlorophenyl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 71663028) has the molecular formula C21H21ClN2O2S and a molecular weight of 400.93 g/mol. Its IUPAC name is N-[(2R)-2-anilino-2-(2-chlorophenyl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2R)-2-anilino-2-(2-chlorophenyl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71663028 |
| Molecular Formula | C21H21ClN2O2S |
| Molecular Weight | 400.93 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[(2R)-2-anilino-2-(2-chlorophenyl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC[C@H](Nc2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O2S/c1-16-11-13-18(14-12-16)27(25,26)23-15-21(19-9-5-6-10-20(19)22)24-17-7-3-2-4-8-17/h2-14,21,23-24H,15H2,1H3/t21-/m0/s1 |
| InChIKey | QZTSIZAAAYCQNC-NRFANRHFSA-N |
| XLogP | 4.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.93 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |