C24H22ClNO4S2 — CID 102350984
N-[(2E)-1-(2-chlorophenyl)-2-(4-methylphenyl)sulfonylpenta-2,4-dienyl]benzenesulfonamide (PubChem CID 102350984) has the molecular formula C24H22ClNO4S2 and a molecular weight of 488.03 g/mol. Its IUPAC name is N-[(2E)-1-(2-chlorophenyl)-2-(4-methylphenyl)sulfonylpenta-2,4-dienyl]benzenesulfonamide.
| Compound Name | N-[(2E)-1-(2-chlorophenyl)-2-(4-methylphenyl)sulfonylpenta-2,4-dienyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102350984 |
| Molecular Formula | C24H22ClNO4S2 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | N-[(2E)-1-(2-chlorophenyl)-2-(4-methylphenyl)sulfonylpenta-2,4-dienyl]benzenesulfonamide |
| SMILES | C=C/C=C(\C(NS(=O)(=O)c1ccccc1)c1ccccc1Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H22ClNO4S2/c1-3-9-23(31(27,28)19-16-14-18(2)15-17-19)24(21-12-7-8-13-22(21)25)26-32(29,30)20-10-5-4-6-11-20/h3-17,24,26H,1H2,2H3/b23-9+ |
| InChIKey | XHAVZJLWISQZGP-NUGSKGIGSA-N |
| XLogP | 5.21 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|