C12H11ClN2O4S — CID 107314959
(2R)-2-(2-chlorophenyl)-2-(1H-pyrrol-3-ylsulfonylamino)acetic acid (PubChem CID 107314959) has the molecular formula C12H11ClN2O4S and a molecular weight of 314.75 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-(1H-pyrrol-3-ylsulfonylamino)acetic acid.
| Compound Name | (2R)-2-(2-chlorophenyl)-2-(1H-pyrrol-3-ylsulfonylamino)acetic acid |
|---|---|
| PubChem CID | 107314959 |
| Molecular Formula | C12H11ClN2O4S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2-(1H-pyrrol-3-ylsulfonylamino)acetic acid |
| SMILES | O=C(O)[C@H](NS(=O)(=O)c1cc[nH]c1)c1ccccc1Cl |
| InChI | InChI=1S/C12H11ClN2O4S/c13-10-4-2-1-3-9(10)11(12(16)17)15-20(18,19)8-5-6-14-7-8/h1-7,11,14-15H,(H,16,17)/t11-/m1/s1 |
| InChIKey | ICVWOHNEMRHIOK-LLVKDONJSA-N |
| XLogP | 1.77 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |