C8H12N2O5S — CID 43294291
3-hydroxy-2-(1H-pyrrol-3-ylsulfonylamino)butanoic acid (PubChem CID 43294291) has the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. Its IUPAC name is 3-hydroxy-2-(1H-pyrrol-3-ylsulfonylamino)butanoic acid.
| Compound Name | 3-hydroxy-2-(1H-pyrrol-3-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 43294291 |
| Molecular Formula | C8H12N2O5S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 3-hydroxy-2-(1H-pyrrol-3-ylsulfonylamino)butanoic acid |
| SMILES | CC(O)C(NS(=O)(=O)c1cc[nH]c1)C(=O)O |
| InChI | InChI=1S/C8H12N2O5S/c1-5(11)7(8(12)13)10-16(14,15)6-2-3-9-4-6/h2-5,7,9-11H,1H3,(H,12,13) |
| InChIKey | ASXILMXVYOFIPI-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |