C14H16O3S — CID 11615925
(3R,4E)-4-(4-methylphenyl)sulfonylhepta-1,4,6-trien-3-ol (PubChem CID 11615925) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is (3R,4E)-4-(4-methylphenyl)sulfonylhepta-1,4,6-trien-3-ol.
| Compound Name | (3R,4E)-4-(4-methylphenyl)sulfonylhepta-1,4,6-trien-3-ol |
|---|---|
| PubChem CID | 11615925 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (3R,4E)-4-(4-methylphenyl)sulfonylhepta-1,4,6-trien-3-ol |
| SMILES | C=C/C=C(\[C@H](O)C=C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16O3S/c1-4-6-14(13(15)5-2)18(16,17)12-9-7-11(3)8-10-12/h4-10,13,15H,1-2H2,3H3/b14-6+/t13-/m1/s1 |
| InChIKey | IVTLQNXUVMUPNU-IAEDUXEVSA-N |
| XLogP | 2.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|