C17H26O3S — CID 11023323
(E,3S)-2-methyl-4-(4-methylphenyl)sulfonylnon-4-en-3-ol (PubChem CID 11023323) has the molecular formula C17H26O3S and a molecular weight of 310.46 g/mol. Its IUPAC name is (E,3S)-2-methyl-4-(4-methylphenyl)sulfonylnon-4-en-3-ol.
| Compound Name | (E,3S)-2-methyl-4-(4-methylphenyl)sulfonylnon-4-en-3-ol |
|---|---|
| PubChem CID | 11023323 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (E,3S)-2-methyl-4-(4-methylphenyl)sulfonylnon-4-en-3-ol |
| SMILES | CCCC/C=C(\[C@@H](O)C(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H26O3S/c1-5-6-7-8-16(17(18)13(2)3)21(19,20)15-11-9-14(4)10-12-15/h8-13,17-18H,5-7H2,1-4H3/b16-8+/t17-/m0/s1 |
| InChIKey | PCJLOWWZNHQQIB-BDBSJLECSA-N |
| XLogP | 3.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|