C16H22O2S — CID 102080230
1-methyl-4-[(4Z)-nona-1,4-dien-4-yl]sulfonylbenzene (PubChem CID 102080230) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-methyl-4-[(4Z)-nona-1,4-dien-4-yl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[(4Z)-nona-1,4-dien-4-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 102080230 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-methyl-4-[(4Z)-nona-1,4-dien-4-yl]sulfonylbenzene |
| SMILES | C=CC/C(=C/CCCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O2S/c1-4-6-7-9-15(8-5-2)19(17,18)16-12-10-14(3)11-13-16/h5,9-13H,2,4,6-8H2,1,3H3/b15-9- |
| InChIKey | STOCVFTYMDCOGJ-DHDCSXOGSA-N |
| XLogP | 4.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|