C19H19ClO2S — CID 132603640
1-[(1E)-1-chloro-2-(4-methylphenyl)sulfonylpenta-1,4-dienyl]-4-methylbenzene (PubChem CID 132603640) has the molecular formula C19H19ClO2S and a molecular weight of 346.88 g/mol. Its IUPAC name is 1-[(1E)-1-chloro-2-(4-methylphenyl)sulfonylpenta-1,4-dienyl]-4-methylbenzene.
| Compound Name | 1-[(1E)-1-chloro-2-(4-methylphenyl)sulfonylpenta-1,4-dienyl]-4-methylbenzene |
|---|---|
| PubChem CID | 132603640 |
| Molecular Formula | C19H19ClO2S |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-[(1E)-1-chloro-2-(4-methylphenyl)sulfonylpenta-1,4-dienyl]-4-methylbenzene |
| SMILES | C=CC/C(=C(\Cl)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H19ClO2S/c1-4-5-18(19(20)16-10-6-14(2)7-11-16)23(21,22)17-12-8-15(3)9-13-17/h4,6-13H,1,5H2,2-3H3/b19-18+ |
| InChIKey | AJZZKOYRAUZXIM-VHEBQXMUSA-N |
| XLogP | 5.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|