C25H24O2S — CID 101475370
1-[(2Z)-1,3-diphenylhexa-2,5-dien-2-yl]sulfonyl-4-methylbenzene (PubChem CID 101475370) has the molecular formula C25H24O2S and a molecular weight of 388.53 g/mol. Its IUPAC name is 1-[(2Z)-1,3-diphenylhexa-2,5-dien-2-yl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[(2Z)-1,3-diphenylhexa-2,5-dien-2-yl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 101475370 |
| Molecular Formula | C25H24O2S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-[(2Z)-1,3-diphenylhexa-2,5-dien-2-yl]sulfonyl-4-methylbenzene |
| SMILES | C=CC/C(=C(\Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H24O2S/c1-3-10-24(22-13-8-5-9-14-22)25(19-21-11-6-4-7-12-21)28(26,27)23-17-15-20(2)16-18-23/h3-9,11-18H,1,10,19H2,2H3/b25-24- |
| InChIKey | ZZJFCKPGUMMVMG-IZHYLOQSSA-N |
| XLogP | 6.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|