C26H28Si — CID 101475811
benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane (PubChem CID 101475811) has the molecular formula C26H28Si and a molecular weight of 368.60 g/mol. Its IUPAC name is benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane.
| Compound Name | benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane |
|---|---|
| PubChem CID | 101475811 |
| Molecular Formula | C26H28Si |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane |
| SMILES | C=CC/C(=C(\c1ccccc1)[Si](C)(C)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28Si/c1-4-14-25(23-17-10-6-11-18-23)26(24-19-12-7-13-20-24)27(2,3)21-22-15-8-5-9-16-22/h4-13,15-20H,1,14,21H2,2-3H3/b26-25- |
| InChIKey | MFGYQFFEXNYLNC-QPLCGJKRSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|