About benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane
benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane (PubChem CID 101475811) has the molecular formula C26H28Si
and a molecular weight of 368.60 g/mol. Its IUPAC name is benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane.
Molecular Properties
| Compound Name | benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane |
| PubChem CID | 101475811 |
| Molecular Formula | C26H28Si |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane |
| SMILES | C=CC/C(=C(\c1ccccc1)[Si](C)(C)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28Si/c1-4-14-25(23-17-10-6-11-18-23)26(24-19-12-7-13-20-24)27(2,3)21-22-15-8-5-9-16-22/h4-13,15-20H,1,14,21H2,2-3H3/b26-25- |
| InChIKey | MFGYQFFEXNYLNC-QPLCGJKRSA-N |
| XLogP | 7.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane?
The IUPAC name of benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane (CID 101475811) is benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane.
What is the SMILES notation for benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane?
The canonical SMILES for benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane is C=CC/C(=C(\c1ccccc1)[Si](C)(C)Cc1ccccc1)c1ccccc1.
What is the InChIKey of benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane?
The InChIKey is MFGYQFFEXNYLNC-QPLCGJKRSA-N. The full InChI is InChI=1S/C26H28Si/c1-4-14-25(23-17-10-6-11-18-23)26(24-19-12-7-13-20-24)27(2,3)21-22-15-8-5-9-16-22/h4-13,15-20H,1,14,21H2,2-3H3/b26-25-.
What are the key properties of benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane?
benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane has a molecular weight of 368.60 g/mol, XLogP of 7.20, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[(1Z)-1,2-diphenylpenta-1,4-dienyl]-dimethylsilane is sourced from PubChem (CID 101475811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).