C18H28Si — CID 102246919
trimethyl-[(Z)-1-phenyl-2-prop-2-enylhex-1-enyl]silane (PubChem CID 102246919) has the molecular formula C18H28Si and a molecular weight of 272.51 g/mol. Its IUPAC name is trimethyl-[(Z)-1-phenyl-2-prop-2-enylhex-1-enyl]silane.
| Compound Name | trimethyl-[(Z)-1-phenyl-2-prop-2-enylhex-1-enyl]silane |
|---|---|
| PubChem CID | 102246919 |
| Molecular Formula | C18H28Si |
| Molecular Weight | 272.51 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | trimethyl-[(Z)-1-phenyl-2-prop-2-enylhex-1-enyl]silane |
| SMILES | C=CC/C(CCCC)=C(/c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C18H28Si/c1-6-8-13-16(12-7-2)18(19(3,4)5)17-14-10-9-11-15-17/h7,9-11,14-15H,2,6,8,12-13H2,1,3-5H3/b18-16+ |
| InChIKey | BZICYAHIGNKRJI-FBMGVBCBSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|