C23H28 — CID 173389416
1-methyl-4-(6-phenyldeca-3,5-dien-3-yl)benzene (PubChem CID 173389416) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-methyl-4-(6-phenyldeca-3,5-dien-3-yl)benzene.
| Compound Name | 1-methyl-4-(6-phenyldeca-3,5-dien-3-yl)benzene |
|---|---|
| PubChem CID | 173389416 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-methyl-4-(6-phenyldeca-3,5-dien-3-yl)benzene |
| SMILES | CCCCC(=CC=C(CC)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H28/c1-4-6-10-22(21-11-8-7-9-12-21)18-17-20(5-2)23-15-13-19(3)14-16-23/h7-9,11-18H,4-6,10H2,1-3H3 |
| InChIKey | OVAPHSQWKWXGHP-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|