C25H32 — CID 10544592
1-[(1E,3Z)-2-butyl-3-phenylocta-1,3-dienyl]-4-methylbenzene (PubChem CID 10544592) has the molecular formula C25H32 and a molecular weight of 332.53 g/mol. Its IUPAC name is 1-[(1E,3Z)-2-butyl-3-phenylocta-1,3-dienyl]-4-methylbenzene.
| Compound Name | 1-[(1E,3Z)-2-butyl-3-phenylocta-1,3-dienyl]-4-methylbenzene |
|---|---|
| PubChem CID | 10544592 |
| Molecular Formula | C25H32 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 1-[(1E,3Z)-2-butyl-3-phenylocta-1,3-dienyl]-4-methylbenzene |
| SMILES | CCCC/C=C(C(=C/c1ccc(C)cc1)/CCCC)\c1ccccc1 |
| InChI | InChI=1S/C25H32/c1-4-6-9-15-25(23-13-10-8-11-14-23)24(12-7-5-2)20-22-18-16-21(3)17-19-22/h8,10-11,13-20H,4-7,9,12H2,1-3H3/b24-20+,25-15+ |
| InChIKey | NVPXAWNGALBKSR-IXMIJWNDSA-N |
| XLogP | 7.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|