C23H30Si — CID 10437633
2-(1,2-diphenylethenyl)hex-1-enyl-trimethylsilane (PubChem CID 10437633) has the molecular formula C23H30Si and a molecular weight of 334.58 g/mol. Its IUPAC name is 2-(1,2-diphenylethenyl)hex-1-enyl-trimethylsilane.
| Compound Name | 2-(1,2-diphenylethenyl)hex-1-enyl-trimethylsilane |
|---|---|
| PubChem CID | 10437633 |
| Molecular Formula | C23H30Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-(1,2-diphenylethenyl)hex-1-enyl-trimethylsilane |
| SMILES | CCCCC(=C[Si](C)(C)C)C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30Si/c1-5-6-15-22(19-24(2,3)4)23(21-16-11-8-12-17-21)18-20-13-9-7-10-14-20/h7-14,16-19H,5-6,15H2,1-4H3 |
| InChIKey | VZKMFPWWRKZLIP-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|