C22H34ClNO2S — CID 56648807
N-benzyl-N-[(Z)-1-chloro-2-prop-2-enylundec-1-enyl]methanesulfonamide (PubChem CID 56648807) has the molecular formula C22H34ClNO2S and a molecular weight of 412.04 g/mol. Its IUPAC name is N-benzyl-N-[(Z)-1-chloro-2-prop-2-enylundec-1-enyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[(Z)-1-chloro-2-prop-2-enylundec-1-enyl]methanesulfonamide |
|---|---|
| PubChem CID | 56648807 |
| Molecular Formula | C22H34ClNO2S |
| Molecular Weight | 412.04 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-benzyl-N-[(Z)-1-chloro-2-prop-2-enylundec-1-enyl]methanesulfonamide |
| SMILES | C=CC/C(CCCCCCCCC)=C(\Cl)N(Cc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H34ClNO2S/c1-4-6-7-8-9-10-14-18-21(15-5-2)22(23)24(27(3,25)26)19-20-16-12-11-13-17-20/h5,11-13,16-17H,2,4,6-10,14-15,18-19H2,1,3H3/b22-21- |
| InChIKey | XXOYYMWBDXKJES-DQRAZIAOSA-N |
| XLogP | 6.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.04 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|