C31H49NO4 — CID 172835899
1-[benzyl(3,6-dioxododecyl)amino]dodecane-3,6-dione (PubChem CID 172835899) has the molecular formula C31H49NO4 and a molecular weight of 499.74 g/mol. Its IUPAC name is 1-[benzyl(3,6-dioxododecyl)amino]dodecane-3,6-dione.
| Compound Name | 1-[benzyl(3,6-dioxododecyl)amino]dodecane-3,6-dione |
|---|---|
| PubChem CID | 172835899 |
| Molecular Formula | C31H49NO4 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.37 |
| IUPAC Name | 1-[benzyl(3,6-dioxododecyl)amino]dodecane-3,6-dione |
| SMILES | CCCCCCC(=O)CCC(=O)CCN(CCC(=O)CCC(=O)CCCCCC)Cc1ccccc1 |
| InChI | InChI=1S/C31H49NO4/c1-3-5-7-12-16-28(33)18-20-30(35)22-24-32(26-27-14-10-9-11-15-27)25-23-31(36)21-19-29(34)17-13-8-6-4-2/h9-11,14-15H,3-8,12-13,16-26H2,1-2H3 |
| InChIKey | WDLATSDYOXYTGZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|