C20H22ClNO2S — CID 56648636
N-benzyl-N-[(1E)-1-chloro-4-methyl-2-phenylpenta-1,4-dienyl]methanesulfonamide (PubChem CID 56648636) has the molecular formula C20H22ClNO2S and a molecular weight of 375.92 g/mol. Its IUPAC name is N-benzyl-N-[(1E)-1-chloro-4-methyl-2-phenylpenta-1,4-dienyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[(1E)-1-chloro-4-methyl-2-phenylpenta-1,4-dienyl]methanesulfonamide |
|---|---|
| PubChem CID | 56648636 |
| Molecular Formula | C20H22ClNO2S |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-benzyl-N-[(1E)-1-chloro-4-methyl-2-phenylpenta-1,4-dienyl]methanesulfonamide |
| SMILES | C=C(C)C/C(=C(\Cl)N(Cc1ccccc1)S(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C20H22ClNO2S/c1-16(2)14-19(18-12-8-5-9-13-18)20(21)22(25(3,23)24)15-17-10-6-4-7-11-17/h4-13H,1,14-15H2,2-3H3/b20-19- |
| InChIKey | QHERJNPMZIZOPW-VXPUYCOJSA-N |
| XLogP | 5.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|