C19H19Cl2NO2S — CID 56648715
N-benzyl-N-[(1E)-1-chloro-2-(4-chlorophenyl)penta-1,4-dienyl]methanesulfonamide (PubChem CID 56648715) has the molecular formula C19H19Cl2NO2S and a molecular weight of 396.34 g/mol. Its IUPAC name is N-benzyl-N-[(1E)-1-chloro-2-(4-chlorophenyl)penta-1,4-dienyl]methanesulfonamide.
| Compound Name | N-benzyl-N-[(1E)-1-chloro-2-(4-chlorophenyl)penta-1,4-dienyl]methanesulfonamide |
|---|---|
| PubChem CID | 56648715 |
| Molecular Formula | C19H19Cl2NO2S |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | N-benzyl-N-[(1E)-1-chloro-2-(4-chlorophenyl)penta-1,4-dienyl]methanesulfonamide |
| SMILES | C=CC/C(=C(\Cl)N(Cc1ccccc1)S(C)(=O)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19Cl2NO2S/c1-3-7-18(16-10-12-17(20)13-11-16)19(21)22(25(2,23)24)14-15-8-5-4-6-9-15/h3-6,8-13H,1,7,14H2,2H3/b19-18- |
| InChIKey | JJGHSPBBXUQWCI-HNENSFHCSA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|