C31H39NO2S — CID 134922780
N-benzyl-4-methyl-N-[(E)-5-phenylundec-4-en-4-yl]benzenesulfonamide (PubChem CID 134922780) has the molecular formula C31H39NO2S and a molecular weight of 489.73 g/mol. Its IUPAC name is N-benzyl-4-methyl-N-[(E)-5-phenylundec-4-en-4-yl]benzenesulfonamide.
| Compound Name | N-benzyl-4-methyl-N-[(E)-5-phenylundec-4-en-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134922780 |
| Molecular Formula | C31H39NO2S |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | N-benzyl-4-methyl-N-[(E)-5-phenylundec-4-en-4-yl]benzenesulfonamide |
| SMILES | CCCCCC/C(=C(/CCC)N(Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H39NO2S/c1-4-6-7-14-20-30(28-18-12-9-13-19-28)31(15-5-2)32(25-27-16-10-8-11-17-27)35(33,34)29-23-21-26(3)22-24-29/h8-13,16-19,21-24H,4-7,14-15,20,25H2,1-3H3/b31-30+ |
| InChIKey | RAVSAMWUWLDLJD-NVQSTNCTSA-N |
| XLogP | 8.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|