C30H28N2O4S2 — CID 162397950
N-benzyl-N-[2-[benzyl-(4-methylphenyl)sulfonylamino]ethynyl]-4-methylbenzenesulfonamide (PubChem CID 162397950) has the molecular formula C30H28N2O4S2 and a molecular weight of 544.70 g/mol. Its IUPAC name is N-benzyl-N-[2-[benzyl-(4-methylphenyl)sulfonylamino]ethynyl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[2-[benzyl-(4-methylphenyl)sulfonylamino]ethynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 162397950 |
| Molecular Formula | C30H28N2O4S2 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | N-benzyl-N-[2-[benzyl-(4-methylphenyl)sulfonylamino]ethynyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C#CN(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2O4S2/c1-25-13-17-29(18-14-25)37(33,34)31(23-27-9-5-3-6-10-27)21-22-32(24-28-11-7-4-8-12-28)38(35,36)30-19-15-26(2)16-20-30/h3-20H,23-24H2,1-2H3 |
| InChIKey | MWYRXUJXYFJZAW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|