C22H21N5O2S — CID 123162649
N-benzyl-N-[(4-methylphenyl)methyl]-4-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 123162649) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-benzyl-N-[(4-methylphenyl)methyl]-4-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | N-benzyl-N-[(4-methylphenyl)methyl]-4-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 123162649 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-benzyl-N-[(4-methylphenyl)methyl]-4-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | Cc1ccc(CN(Cc2ccccc2)S(=O)(=O)c2ccc(-c3nn[nH]n3)cc2)cc1 |
| InChI | InChI=1S/C22H21N5O2S/c1-17-7-9-19(10-8-17)16-27(15-18-5-3-2-4-6-18)30(28,29)21-13-11-20(12-14-21)22-23-25-26-24-22/h2-14H,15-16H2,1H3,(H,23,24,25,26) |
| InChIKey | VHUAHCDPFWVUCN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |