C21H17ClFN5O2S — CID 66930484
N-benzyl-4-chloro-2-fluoro-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 66930484) has the molecular formula C21H17ClFN5O2S and a molecular weight of 457.92 g/mol. Its IUPAC name is N-benzyl-4-chloro-2-fluoro-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | N-benzyl-4-chloro-2-fluoro-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66930484 |
| Molecular Formula | C21H17ClFN5O2S |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-benzyl-4-chloro-2-fluoro-N-[[4-(2H-tetrazol-5-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)cc1F)N(Cc1ccccc1)Cc1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C21H17ClFN5O2S/c22-18-10-11-20(19(23)12-18)31(29,30)28(13-15-4-2-1-3-5-15)14-16-6-8-17(9-7-16)21-24-26-27-25-21/h1-12H,13-14H2,(H,24,25,26,27) |
| InChIKey | PEUOGJMQPOIJKO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |