C28H18N2O4S — CID 135069917
N-benzyl-4-methyl-N-[8-(4-nitrophenyl)octa-1,3,5,7-tetraynyl]benzenesulfonamide (PubChem CID 135069917) has the molecular formula C28H18N2O4S and a molecular weight of 478.53 g/mol. Its IUPAC name is N-benzyl-4-methyl-N-[8-(4-nitrophenyl)octa-1,3,5,7-tetraynyl]benzenesulfonamide.
| Compound Name | N-benzyl-4-methyl-N-[8-(4-nitrophenyl)octa-1,3,5,7-tetraynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135069917 |
| Molecular Formula | C28H18N2O4S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-benzyl-4-methyl-N-[8-(4-nitrophenyl)octa-1,3,5,7-tetraynyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C#CC#CC#CC#Cc2ccc([N+](=O)[O-])cc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H18N2O4S/c1-24-14-20-28(21-15-24)35(33,34)29(23-26-12-8-6-9-13-26)22-10-5-3-2-4-7-11-25-16-18-27(19-17-25)30(31)32/h6,8-9,12-21H,23H2,1H3 |
| InChIKey | YIVVYSHXSZNKSB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|