C24H20ClNO2S — CID 129127567
N-benzyl-N-[(E)-4-(4-chlorophenyl)but-3-en-1-ynyl]-4-methylbenzenesulfonamide (PubChem CID 129127567) has the molecular formula C24H20ClNO2S and a molecular weight of 421.95 g/mol. Its IUPAC name is N-benzyl-N-[(E)-4-(4-chlorophenyl)but-3-en-1-ynyl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[(E)-4-(4-chlorophenyl)but-3-en-1-ynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 129127567 |
| Molecular Formula | C24H20ClNO2S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-benzyl-N-[(E)-4-(4-chlorophenyl)but-3-en-1-ynyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C#C/C=C/c2ccc(Cl)cc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H20ClNO2S/c1-20-10-16-24(17-11-20)29(27,28)26(19-22-8-3-2-4-9-22)18-6-5-7-21-12-14-23(25)15-13-21/h2-5,7-17H,19H2,1H3/b7-5+ |
| InChIKey | VGUJNYWNKRHUBN-FNORWQNLSA-N |
| XLogP | 5.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|