C29H26Cl2N2O3S — CID 43891681
N,N-dibenzyl-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 43891681) has the molecular formula C29H26Cl2N2O3S and a molecular weight of 553.51 g/mol. Its IUPAC name is N,N-dibenzyl-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N,N-dibenzyl-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43891681 |
| Molecular Formula | C29H26Cl2N2O3S |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | N,N-dibenzyl-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N(Cc2ccccc2)Cc2ccccc2)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C29H26Cl2N2O3S/c1-22-12-14-28(15-13-22)37(35,36)33(27-17-25(30)16-26(31)18-27)21-29(34)32(19-23-8-4-2-5-9-23)20-24-10-6-3-7-11-24/h2-18H,19-21H2,1H3 |
| InChIKey | ITRDCFMBOAUJQK-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |