C30H29ClN2O3S — CID 43891702
N,N-dibenzyl-2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 43891702) has the molecular formula C30H29ClN2O3S and a molecular weight of 533.09 g/mol. Its IUPAC name is N,N-dibenzyl-2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N,N-dibenzyl-2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43891702 |
| Molecular Formula | C30H29ClN2O3S |
| Molecular Weight | 533.09 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | N,N-dibenzyl-2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N(Cc2ccccc2)Cc2ccccc2)c2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C30H29ClN2O3S/c1-23-16-18-27(19-17-23)37(35,36)33(29-15-9-14-28(31)24(29)2)22-30(34)32(20-25-10-5-3-6-11-25)21-26-12-7-4-8-13-26/h3-19H,20-22H2,1-2H3 |
| InChIKey | WZOHXAZGDFGDQT-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.09 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |