C36H32N2O4S2 — CID 102582934
N-[3-[benzyl-(4-methylphenyl)sulfonylamino]-1,1-diphenylprop-2-ynyl]-4-methylbenzenesulfonamide (PubChem CID 102582934) has the molecular formula C36H32N2O4S2 and a molecular weight of 620.80 g/mol. Its IUPAC name is N-[3-[benzyl-(4-methylphenyl)sulfonylamino]-1,1-diphenylprop-2-ynyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-[benzyl-(4-methylphenyl)sulfonylamino]-1,1-diphenylprop-2-ynyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102582934 |
| Molecular Formula | C36H32N2O4S2 |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.18 |
| IUPAC Name | N-[3-[benzyl-(4-methylphenyl)sulfonylamino]-1,1-diphenylprop-2-ynyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C#CN(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H32N2O4S2/c1-29-18-22-34(23-19-29)43(39,40)37-36(32-14-8-4-9-15-32,33-16-10-5-11-17-33)26-27-38(28-31-12-6-3-7-13-31)44(41,42)35-24-20-30(2)21-25-35/h3-25,37H,28H2,1-2H3 |
| InChIKey | IVOHMDPKWVMQOJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.80 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|