C26H25FO — CID 57253608
1-ethoxy-4-[(2Z)-1-(4-fluorophenyl)-3-phenylhexa-2,5-dien-2-yl]benzene (PubChem CID 57253608) has the molecular formula C26H25FO and a molecular weight of 372.48 g/mol. Its IUPAC name is 1-ethoxy-4-[(2Z)-1-(4-fluorophenyl)-3-phenylhexa-2,5-dien-2-yl]benzene.
| Compound Name | 1-ethoxy-4-[(2Z)-1-(4-fluorophenyl)-3-phenylhexa-2,5-dien-2-yl]benzene |
|---|---|
| PubChem CID | 57253608 |
| Molecular Formula | C26H25FO |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-ethoxy-4-[(2Z)-1-(4-fluorophenyl)-3-phenylhexa-2,5-dien-2-yl]benzene |
| SMILES | C=CC/C(=C(\Cc1ccc(F)cc1)c1ccc(OCC)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H25FO/c1-3-8-25(21-9-6-5-7-10-21)26(19-20-11-15-23(27)16-12-20)22-13-17-24(18-14-22)28-4-2/h3,5-7,9-18H,1,4,8,19H2,2H3/b26-25- |
| InChIKey | OZVXKIAHVGSZHX-QPLCGJKRSA-N |
| XLogP | 6.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|