C20H22O — CID 57173375
1-ethoxy-4-[(2Z)-3-phenylhexa-2,5-dienyl]benzene (PubChem CID 57173375) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-ethoxy-4-[(2Z)-3-phenylhexa-2,5-dienyl]benzene.
| Compound Name | 1-ethoxy-4-[(2Z)-3-phenylhexa-2,5-dienyl]benzene |
|---|---|
| PubChem CID | 57173375 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-ethoxy-4-[(2Z)-3-phenylhexa-2,5-dienyl]benzene |
| SMILES | C=CC/C(=C/Cc1ccc(OCC)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H22O/c1-3-8-18(19-9-6-5-7-10-19)14-11-17-12-15-20(16-13-17)21-4-2/h3,5-7,9-10,12-16H,1,4,8,11H2,2H3/b18-14- |
| InChIKey | XKIGJWZBEZJUJZ-JXAWBTAJSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|