About 1-ethoxy-4-phenylbenzene;phenol
1-ethoxy-4-phenylbenzene;phenol (PubChem CID 174652155) has the molecular formula C20H20O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-ethoxy-4-phenylbenzene;phenol.
Molecular Properties
| Compound Name | 1-ethoxy-4-phenylbenzene;phenol |
| PubChem CID | 174652155 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-ethoxy-4-phenylbenzene;phenol |
| SMILES | CCOc1ccc(-c2ccccc2)cc1.Oc1ccccc1 |
| InChI | InChI=1S/C14H14O.C6H6O/c1-2-15-14-10-8-13(9-11-14)12-6-4-3-5-7-12;7-6-4-2-1-3-5-6/h3-11H,2H2,1H3;1-5,7H |
| InChIKey | QAPYQWUULCKAKU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethoxy-4-phenylbenzene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-4-phenylbenzene;phenol?
The IUPAC name of 1-ethoxy-4-phenylbenzene;phenol (CID 174652155) is 1-ethoxy-4-phenylbenzene;phenol.
What is the SMILES notation for 1-ethoxy-4-phenylbenzene;phenol?
The canonical SMILES for 1-ethoxy-4-phenylbenzene;phenol is CCOc1ccc(-c2ccccc2)cc1.Oc1ccccc1.
What is the InChIKey of 1-ethoxy-4-phenylbenzene;phenol?
The InChIKey is QAPYQWUULCKAKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C6H6O/c1-2-15-14-10-8-13(9-11-14)12-6-4-3-5-7-12;7-6-4-2-1-3-5-6/h3-11H,2H2,1H3;1-5,7H.
What are the key properties of 1-ethoxy-4-phenylbenzene;phenol?
1-ethoxy-4-phenylbenzene;phenol has a molecular weight of 292.38 g/mol, XLogP of 5.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-4-phenylbenzene;phenol is sourced from PubChem (CID 174652155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).