About ethoxybenzene tetrafluoroborate
ethoxybenzene tetrafluoroborate (PubChem CID 174807216) has the molecular formula C8H10BF4O-
and a molecular weight of 208.97 g/mol. Its IUPAC name is ethoxybenzene tetrafluoroborate.
Molecular Properties
| Compound Name | ethoxybenzene tetrafluoroborate |
| PubChem CID | 174807216 |
| Molecular Formula | C8H10BF4O- |
| Molecular Weight | 208.97 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | ethoxybenzene tetrafluoroborate |
| SMILES | CCOc1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C8H10O.BF4/c1-2-9-8-6-4-3-5-7-8;2-1(3,4)5/h3-7H,2H2,1H3;/q;-1 |
| InChIKey | MISFBOALALQUBJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.97 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethoxybenzene tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxybenzene tetrafluoroborate?
The IUPAC name of ethoxybenzene tetrafluoroborate (CID 174807216) is ethoxybenzene tetrafluoroborate.
What is the SMILES notation for ethoxybenzene tetrafluoroborate?
The canonical SMILES for ethoxybenzene tetrafluoroborate is CCOc1ccccc1.F[B-](F)(F)F.
What is the InChIKey of ethoxybenzene tetrafluoroborate?
The InChIKey is MISFBOALALQUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.BF4/c1-2-9-8-6-4-3-5-7-8;2-1(3,4)5/h3-7H,2H2,1H3;/q;-1.
What are the key properties of ethoxybenzene tetrafluoroborate?
ethoxybenzene tetrafluoroborate has a molecular weight of 208.97 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxybenzene tetrafluoroborate is sourced from PubChem (CID 174807216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).