C17H21NO3 — CID 162120306
benzamide;1,4-diethoxybenzene (PubChem CID 162120306) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is benzamide;1,4-diethoxybenzene.
| Compound Name | benzamide;1,4-diethoxybenzene |
|---|---|
| PubChem CID | 162120306 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | benzamide;1,4-diethoxybenzene |
| SMILES | CCOc1ccc(OCC)cc1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H14O2.C7H7NO/c1-3-11-9-5-7-10(8-6-9)12-4-2;8-7(9)6-4-2-1-3-5-6/h5-8H,3-4H2,1-2H3;1-5H,(H2,8,9) |
| InChIKey | ZHHZZIGHCJYCCO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |