C18H20N2O2 — CID 3420448
N'-[1-(4-ethoxyphenyl)ethenyl]-2-phenylacetohydrazide (PubChem CID 3420448) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N'-[1-(4-ethoxyphenyl)ethenyl]-2-phenylacetohydrazide.
| Compound Name | N'-[1-(4-ethoxyphenyl)ethenyl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 3420448 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N'-[1-(4-ethoxyphenyl)ethenyl]-2-phenylacetohydrazide |
| SMILES | C=C(NNC(=O)Cc1ccccc1)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C18H20N2O2/c1-3-22-17-11-9-16(10-12-17)14(2)19-20-18(21)13-15-7-5-4-6-8-15/h4-12,19H,2-3,13H2,1H3,(H,20,21) |
| InChIKey | RSYJBFKMJLAOBY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|