C24H23FN2O4 — CID 8502972
4-[(4-ethoxyphenoxy)methyl]-N'-[2-(2-fluorophenyl)acetyl]benzohydrazide (PubChem CID 8502972) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is 4-[(4-ethoxyphenoxy)methyl]-N'-[2-(2-fluorophenyl)acetyl]benzohydrazide.
| Compound Name | 4-[(4-ethoxyphenoxy)methyl]-N'-[2-(2-fluorophenyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8502972 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 4-[(4-ethoxyphenoxy)methyl]-N'-[2-(2-fluorophenyl)acetyl]benzohydrazide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)NNC(=O)Cc3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C24H23FN2O4/c1-2-30-20-11-13-21(14-12-20)31-16-17-7-9-18(10-8-17)24(29)27-26-23(28)15-19-5-3-4-6-22(19)25/h3-14H,2,15-16H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | ZRWNSZOMCNKQGZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|