C16H22O3S — CID 71367584
(2S)-4-(4-methylphenyl)sulfonylnona-3,5-dien-2-ol (PubChem CID 71367584) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is (2S)-4-(4-methylphenyl)sulfonylnona-3,5-dien-2-ol.
| Compound Name | (2S)-4-(4-methylphenyl)sulfonylnona-3,5-dien-2-ol |
|---|---|
| PubChem CID | 71367584 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2S)-4-(4-methylphenyl)sulfonylnona-3,5-dien-2-ol |
| SMILES | CCCC=CC(=C[C@H](C)O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O3S/c1-4-5-6-7-16(12-14(3)17)20(18,19)15-10-8-13(2)9-11-15/h6-12,14,17H,4-5H2,1-3H3/t14-/m0/s1 |
| InChIKey | XANTZUXKIVJDPU-AWEZNQCLSA-N |
| XLogP | 3.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|