C18H26O3S — CID 101397131
(5R,6E,8E)-7-(4-methylphenyl)sulfonylundeca-6,8-dien-5-ol (PubChem CID 101397131) has the molecular formula C18H26O3S and a molecular weight of 322.47 g/mol. Its IUPAC name is (5R,6E,8E)-7-(4-methylphenyl)sulfonylundeca-6,8-dien-5-ol.
| Compound Name | (5R,6E,8E)-7-(4-methylphenyl)sulfonylundeca-6,8-dien-5-ol |
|---|---|
| PubChem CID | 101397131 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (5R,6E,8E)-7-(4-methylphenyl)sulfonylundeca-6,8-dien-5-ol |
| SMILES | CC/C=C/C(=C\[C@H](O)CCCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H26O3S/c1-4-6-8-16(19)14-18(9-7-5-2)22(20,21)17-12-10-15(3)11-13-17/h7,9-14,16,19H,4-6,8H2,1-3H3/b9-7+,18-14+/t16-/m1/s1 |
| InChIKey | GTOQMZGOXIIHFL-XEVAFRSISA-N |
| XLogP | 4.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|