C19H28O2S — CID 102091567
(5R,6E,8E)-7-(4-methylphenyl)sulfinyldodeca-6,8-dien-5-ol (PubChem CID 102091567) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is (5R,6E,8E)-7-(4-methylphenyl)sulfinyldodeca-6,8-dien-5-ol.
| Compound Name | (5R,6E,8E)-7-(4-methylphenyl)sulfinyldodeca-6,8-dien-5-ol |
|---|---|
| PubChem CID | 102091567 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (5R,6E,8E)-7-(4-methylphenyl)sulfinyldodeca-6,8-dien-5-ol |
| SMILES | CCC/C=C/C(=C\[C@H](O)CCCC)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H28O2S/c1-4-6-8-10-19(15-17(20)9-7-5-2)22(21)18-13-11-16(3)12-14-18/h8,10-15,17,20H,4-7,9H2,1-3H3/b10-8+,19-15+/t17-,22?/m1/s1 |
| InChIKey | AQTBKSNCFFBSBX-WBWYGSDHSA-N |
| XLogP | 4.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|